C29H32N6O3 — CID 54260555
N-[4-acetamido-4-[4-(diethylamino)-2-methylanilino]-5-oxo-1-phenylpyrazol-3-yl]benzamide (PubChem CID 54260555) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-[4-acetamido-4-[4-(diethylamino)-2-methylanilino]-5-oxo-1-phenylpyrazol-3-yl]benzamide.
| Compound Name | N-[4-acetamido-4-[4-(diethylamino)-2-methylanilino]-5-oxo-1-phenylpyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 54260555 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | N-[4-acetamido-4-[4-(diethylamino)-2-methylanilino]-5-oxo-1-phenylpyrazol-3-yl]benzamide |
| SMILES | CCN(CC)c1ccc(NC2(NC(C)=O)C(=O)N(c3ccccc3)N=C2NC(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H32N6O3/c1-5-34(6-2)24-17-18-25(20(3)19-24)32-29(31-21(4)36)27(30-26(37)22-13-9-7-10-14-22)33-35(28(29)38)23-15-11-8-12-16-23/h7-19,32H,5-6H2,1-4H3,(H,31,36)(H,30,33,37) |
| InChIKey | RDEWKJULPXXHTH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|