C28H24N4O2 — CID 23375035
N-[4-anilino-3-(naphthalen-1-ylmethyl)-5-oxo-1-phenylpyrazol-4-yl]acetamide (PubChem CID 23375035) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[4-anilino-3-(naphthalen-1-ylmethyl)-5-oxo-1-phenylpyrazol-4-yl]acetamide.
| Compound Name | N-[4-anilino-3-(naphthalen-1-ylmethyl)-5-oxo-1-phenylpyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 23375035 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-[4-anilino-3-(naphthalen-1-ylmethyl)-5-oxo-1-phenylpyrazol-4-yl]acetamide |
| SMILES | CC(=O)NC1(Nc2ccccc2)C(=O)N(c2ccccc2)N=C1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H24N4O2/c1-20(33)29-28(30-23-14-4-2-5-15-23)26(31-32(27(28)34)24-16-6-3-7-17-24)19-22-13-10-12-21-11-8-9-18-25(21)22/h2-18,30H,19H2,1H3,(H,29,33) |
| InChIKey | MEUPJUDMLBRZDI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|