C17H14N2O3 — CID 91678904
N-(2-anilino-1,3-dioxoinden-2-yl)acetamide (PubChem CID 91678904) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-(2-anilino-1,3-dioxoinden-2-yl)acetamide.
| Compound Name | N-(2-anilino-1,3-dioxoinden-2-yl)acetamide |
|---|---|
| PubChem CID | 91678904 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(2-anilino-1,3-dioxoinden-2-yl)acetamide |
| SMILES | CC(=O)NC1(Nc2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14N2O3/c1-11(20)18-17(19-12-7-3-2-4-8-12)15(21)13-9-5-6-10-14(13)16(17)22/h2-10,19H,1H3,(H,18,20) |
| InChIKey | ZLUBJHCQQYFKAG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|