About 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide
5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide (PubChem CID 67719434) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide.
Molecular Properties
| Compound Name | 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide |
| PubChem CID | 67719434 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.CC1(C)CC(=O)CC(=O)C1 |
| InChI | InChI=1S/C8H9NO.C8H12O2/c1-7(10)9-8-5-3-2-4-6-8;1-8(2)4-6(9)3-7(10)5-8/h2-6H,1H3,(H,9,10);3-5H2,1-2H3 |
| InChIKey | DUYSLCKFKKVBQX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide?
The IUPAC name of 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide (CID 67719434) is 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide.
What is the SMILES notation for 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide?
The canonical SMILES for 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide is CC(=O)Nc1ccccc1.CC1(C)CC(=O)CC(=O)C1.
What is the InChIKey of 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide?
The InChIKey is DUYSLCKFKKVBQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C8H12O2/c1-7(10)9-8-5-3-2-4-6-8;1-8(2)4-6(9)3-7(10)5-8/h2-6H,1H3,(H,9,10);3-5H2,1-2H3.
What are the key properties of 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide?
5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide has a molecular weight of 275.35 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide is sourced from PubChem (CID 67719434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).