C16H21NO3 — CID 67719434
5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide (PubChem CID 67719434) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide.
| Compound Name | 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide |
|---|---|
| PubChem CID | 67719434 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 5,5-dimethylcyclohexane-1,3-dione;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.CC1(C)CC(=O)CC(=O)C1 |
| InChI | InChI=1S/C8H9NO.C8H12O2/c1-7(10)9-8-5-3-2-4-6-8;1-8(2)4-6(9)3-7(10)5-8/h2-6H,1H3,(H,9,10);3-5H2,1-2H3 |
| InChIKey | DUYSLCKFKKVBQX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|