C18H23N3O3 — CID 5349687
N'-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-N-phenylbutanediamide (PubChem CID 5349687) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N'-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-N-phenylbutanediamide.
| Compound Name | N'-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-N-phenylbutanediamide |
|---|---|
| PubChem CID | 5349687 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N'-[(Z)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-N-phenylbutanediamide |
| SMILES | CC1(C)CC(=O)C/C(=N\NC(=O)CCC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2)11-14(10-15(22)12-18)20-21-17(24)9-8-16(23)19-13-6-4-3-5-7-13/h3-7H,8-12H2,1-2H3,(H,19,23)(H,21,24)/b20-14+ |
| InChIKey | PQCODLPDYIOOAV-XSFVSMFZSA-N |
| XLogP | 2.66 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|