C17H23N3O2 — CID 5413708
N'-[(Z)-[(2R)-2-methylcyclohexylidene]amino]-N-phenylbutanediamide (PubChem CID 5413708) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N'-[(Z)-[(2R)-2-methylcyclohexylidene]amino]-N-phenylbutanediamide.
| Compound Name | N'-[(Z)-[(2R)-2-methylcyclohexylidene]amino]-N-phenylbutanediamide |
|---|---|
| PubChem CID | 5413708 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N'-[(Z)-[(2R)-2-methylcyclohexylidene]amino]-N-phenylbutanediamide |
| SMILES | C[C@@H]1CCCC/C1=N/NC(=O)CCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H23N3O2/c1-13-7-5-6-10-15(13)19-20-17(22)12-11-16(21)18-14-8-3-2-4-9-14/h2-4,8-9,13H,5-7,10-12H2,1H3,(H,18,21)(H,20,22)/b19-15-/t13-/m1/s1 |
| InChIKey | MGHPFBZCJUTCGY-YSYRGXBVSA-N |
| XLogP | 3.09 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|