C17H22BrN3O2 — CID 7346988
N-(4-bromophenyl)-N'-[(Z)-[(2S)-2-methylcyclohexylidene]amino]butanediamide (PubChem CID 7346988) has the molecular formula C17H22BrN3O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[(Z)-[(2S)-2-methylcyclohexylidene]amino]butanediamide.
| Compound Name | N-(4-bromophenyl)-N'-[(Z)-[(2S)-2-methylcyclohexylidene]amino]butanediamide |
|---|---|
| PubChem CID | 7346988 |
| Molecular Formula | C17H22BrN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-(4-bromophenyl)-N'-[(Z)-[(2S)-2-methylcyclohexylidene]amino]butanediamide |
| SMILES | C[C@H]1CCCC/C1=N/NC(=O)CCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H22BrN3O2/c1-12-4-2-3-5-15(12)20-21-17(23)11-10-16(22)19-14-8-6-13(18)7-9-14/h6-9,12H,2-5,10-11H2,1H3,(H,19,22)(H,21,23)/b20-15-/t12-/m0/s1 |
| InChIKey | PJPNMPCITGHILI-BMOWLENRSA-N |
| XLogP | 3.85 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|