C12H21N3O2 — CID 9351584
N'-[(Z)-[(2S)-2-methylcyclohexylidene]amino]-N-propan-2-yloxamide (PubChem CID 9351584) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N'-[(Z)-[(2S)-2-methylcyclohexylidene]amino]-N-propan-2-yloxamide.
| Compound Name | N'-[(Z)-[(2S)-2-methylcyclohexylidene]amino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 9351584 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N'-[(Z)-[(2S)-2-methylcyclohexylidene]amino]-N-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)N/N=C1/CCCC[C@@H]1C |
| InChI | InChI=1S/C12H21N3O2/c1-8(2)13-11(16)12(17)15-14-10-7-5-4-6-9(10)3/h8-9H,4-7H2,1-3H3,(H,13,16)(H,15,17)/b14-10-/t9-/m0/s1 |
| InChIKey | KJIBPUWOQKQVNH-DCMHDJSWSA-N |
| XLogP | 1.19 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|