C18H27N3O2 — CID 26869544
(2S)-2-(4-ethoxyanilino)-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]propanamide (PubChem CID 26869544) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2S)-2-(4-ethoxyanilino)-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]propanamide.
| Compound Name | (2S)-2-(4-ethoxyanilino)-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]propanamide |
|---|---|
| PubChem CID | 26869544 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (2S)-2-(4-ethoxyanilino)-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]propanamide |
| SMILES | CCOc1ccc(N[C@@H](C)C(=O)N/N=C2/CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H27N3O2/c1-4-23-16-11-9-15(10-12-16)19-14(3)18(22)21-20-17-8-6-5-7-13(17)2/h9-14,19H,4-8H2,1-3H3,(H,21,22)/b20-17-/t13-,14-/m0/s1 |
| InChIKey | OTUJSBCXCMHNQY-YVVBVMADSA-N |
| XLogP | 3.57 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|