C18H19Br2N3O3 — CID 136887161
(2S)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-(4-ethoxyanilino)propanamide (PubChem CID 136887161) has the molecular formula C18H19Br2N3O3 and a molecular weight of 485.18 g/mol. Its IUPAC name is (2S)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-(4-ethoxyanilino)propanamide.
| Compound Name | (2S)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-(4-ethoxyanilino)propanamide |
|---|---|
| PubChem CID | 136887161 |
| Molecular Formula | C18H19Br2N3O3 |
| Molecular Weight | 485.18 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | (2S)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-(4-ethoxyanilino)propanamide |
| SMILES | CCOc1ccc(N[C@@H](C)C(=O)N/N=C\c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C18H19Br2N3O3/c1-3-26-15-6-4-14(5-7-15)22-11(2)18(25)23-21-10-12-8-13(19)9-16(20)17(12)24/h4-11,22,24H,3H2,1-2H3,(H,23,25)/b21-10-/t11-/m0/s1 |
| InChIKey | MSPZMTHOROMDHK-GVHCZZSVSA-N |
| XLogP | 4.27 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.18 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|