C27H34N6O2S — CID 51529303
(2S)-2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]propanamide (PubChem CID 51529303) has the molecular formula C27H34N6O2S and a molecular weight of 506.68 g/mol. Its IUPAC name is (2S)-2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]propanamide.
| Compound Name | (2S)-2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]propanamide |
|---|---|
| PubChem CID | 51529303 |
| Molecular Formula | C27H34N6O2S |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | (2S)-2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]propanamide |
| SMILES | CCOc1ccc(NCc2nnc(S[C@@H](C)C(=O)N/N=C3/CCCC[C@@H]3C)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H34N6O2S/c1-4-35-23-16-14-21(15-17-23)28-18-25-30-32-27(33(25)22-11-6-5-7-12-22)36-20(3)26(34)31-29-24-13-9-8-10-19(24)2/h5-7,11-12,14-17,19-20,28H,4,8-10,13,18H2,1-3H3,(H,31,34)/b29-24-/t19-,20-/m0/s1 |
| InChIKey | ULZCYFSRIHRZKQ-TWZGQYPMSA-N |
| XLogP | 5.44 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|