C29H30N6O2S2 — CID 17047261
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 17047261) has the molecular formula C29H30N6O2S2 and a molecular weight of 558.73 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 17047261 |
| Molecular Formula | C29H30N6O2S2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CCOc1ccc(NCc2nnc(SCCC(=O)Nc3sc4c(c3C#N)CCCC4)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N6O2S2/c1-2-37-22-14-12-20(13-15-22)31-19-26-33-34-29(35(26)21-8-4-3-5-9-21)38-17-16-27(36)32-28-24(18-30)23-10-6-7-11-25(23)39-28/h3-5,8-9,12-15,31H,2,6-7,10-11,16-17,19H2,1H3,(H,32,36) |
| InChIKey | CXUROKWJCOFSIQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|