C28H28N6OS2 — CID 17047183
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[5-[(3-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 17047183) has the molecular formula C28H28N6OS2 and a molecular weight of 528.71 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[5-[(3-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[5-[(3-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 17047183 |
| Molecular Formula | C28H28N6OS2 |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[[5-[(3-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | Cc1cccc(NCc2nnc(SCCC(=O)Nc3sc4c(c3C#N)CCCC4)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C28H28N6OS2/c1-19-8-7-9-20(16-19)30-18-25-32-33-28(34(25)21-10-3-2-4-11-21)36-15-14-26(35)31-27-23(17-29)22-12-5-6-13-24(22)37-27/h2-4,7-11,16,30H,5-6,12-15,18H2,1H3,(H,31,35) |
| InChIKey | KDGLRLIALNDKHO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |