C25H28N6OS2 — CID 16515203
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-phenyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 16515203) has the molecular formula C25H28N6OS2 and a molecular weight of 492.67 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-phenyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-phenyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16515203 |
| Molecular Formula | C25H28N6OS2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-phenyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | N#Cc1c(NC(=O)CSc2nnc(CN3CCCCC3)n2-c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C25H28N6OS2/c26-15-20-19-11-5-6-12-21(19)34-24(20)27-23(32)17-33-25-29-28-22(16-30-13-7-2-8-14-30)31(25)18-9-3-1-4-10-18/h1,3-4,9-10H,2,5-8,11-14,16-17H2,(H,27,32) |
| InChIKey | ASJWMPFWOFSVQF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |