C28H34N6O2S2 — CID 3812326
N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3812326) has the molecular formula C28H34N6O2S2 and a molecular weight of 550.75 g/mol. Its IUPAC name is N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3812326 |
| Molecular Formula | C28H34N6O2S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-(morpholin-4-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(C)(C)C1CCc2c(sc(NC(=O)CSc3nnc(CN4CCOCC4)n3-c3ccccc3)c2C#N)C1 |
| InChI | InChI=1S/C28H34N6O2S2/c1-28(2,3)19-9-10-21-22(16-29)26(38-23(21)15-19)30-25(35)18-37-27-32-31-24(17-33-11-13-36-14-12-33)34(27)20-7-5-4-6-8-20/h4-8,19H,9-15,17-18H2,1-3H3,(H,30,35) |
| InChIKey | NDBOLHYNVPYFPJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |