C31H33N5O2S2 — CID 137144647
N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 137144647) has the molecular formula C31H33N5O2S2 and a molecular weight of 571.77 g/mol. Its IUPAC name is N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 137144647 |
| Molecular Formula | C31H33N5O2S2 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3sc4c(c3C#N)CC[C@H](C(C)(C)C)C4)nnc2-c2ccccc2O)c(C)c1 |
| InChI | InChI=1S/C31H33N5O2S2/c1-18-10-13-24(19(2)14-18)36-28(22-8-6-7-9-25(22)37)34-35-30(36)39-17-27(38)33-29-23(16-32)21-12-11-20(31(3,4)5)15-26(21)40-29/h6-10,13-14,20,37H,11-12,15,17H2,1-5H3,(H,33,38)/t20-/m0/s1 |
| InChIKey | VJXAEFYKAXDVCK-FQEVSTJZSA-N |
| XLogP | 7.07 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |