C34H33N5O3S2 — CID 137144543
N-benzyl-2-[[2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137144543) has the molecular formula C34H33N5O3S2 and a molecular weight of 623.80 g/mol. Its IUPAC name is N-benzyl-2-[[2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[[2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137144543 |
| Molecular Formula | C34H33N5O3S2 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | N-benzyl-2-[[2-[[4-(2,4-dimethylphenyl)-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3sc4c(c3C(=O)NCc3ccccc3)CCCC4)nnc2-c2ccccc2O)c(C)c1 |
| InChI | InChI=1S/C34H33N5O3S2/c1-21-16-17-26(22(2)18-21)39-31(24-12-6-8-14-27(24)40)37-38-34(39)43-20-29(41)36-33-30(25-13-7-9-15-28(25)44-33)32(42)35-19-23-10-4-3-5-11-23/h3-6,8,10-12,14,16-18,40H,7,9,13,15,19-20H2,1-2H3,(H,35,42)(H,36,41) |
| InChIKey | KXXZWOIGCDXSJK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |