C26H32N6O3S2 — CID 2951890
N-benzyl-2-[[2-[[4-methyl-5-(morpholin-4-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 2951890) has the molecular formula C26H32N6O3S2 and a molecular weight of 540.72 g/mol. Its IUPAC name is N-benzyl-2-[[2-[[4-methyl-5-(morpholin-4-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[[2-[[4-methyl-5-(morpholin-4-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 2951890 |
| Molecular Formula | C26H32N6O3S2 |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | N-benzyl-2-[[2-[[4-methyl-5-(morpholin-4-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cn1c(CN2CCOCC2)nnc1SCC(=O)Nc1sc2c(c1C(=O)NCc1ccccc1)CCCC2 |
| InChI | InChI=1S/C26H32N6O3S2/c1-31-21(16-32-11-13-35-14-12-32)29-30-26(31)36-17-22(33)28-25-23(19-9-5-6-10-20(19)37-25)24(34)27-15-18-7-3-2-4-8-18/h2-4,7-8H,5-6,9-17H2,1H3,(H,27,34)(H,28,33) |
| InChIKey | ZPTWXLMSIFZOPS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |