C30H33N5O4S2 — CID 126360124
N-benzyl-2-[[2-[[4-ethyl-5-[(4-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126360124) has the molecular formula C30H33N5O4S2 and a molecular weight of 591.76 g/mol. Its IUPAC name is N-benzyl-2-[[2-[[4-ethyl-5-[(4-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[[2-[[4-ethyl-5-[(4-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126360124 |
| Molecular Formula | C30H33N5O4S2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | N-benzyl-2-[[2-[[4-ethyl-5-[(4-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCn1c(COc2ccc(OC)cc2)nnc1SCC(=O)Nc1sc2c(c1C(=O)NCc1ccccc1)CCCC2 |
| InChI | InChI=1S/C30H33N5O4S2/c1-3-35-25(18-39-22-15-13-21(38-2)14-16-22)33-34-30(35)40-19-26(36)32-29-27(23-11-7-8-12-24(23)41-29)28(37)31-17-20-9-5-4-6-10-20/h4-6,9-10,13-16H,3,7-8,11-12,17-19H2,1-2H3,(H,31,37)(H,32,36) |
| InChIKey | AEUJTGQHIHXIDD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |