C27H25ClN4O4S2 — CID 126390044
N-benzyl-2-[[2-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126390044) has the molecular formula C27H25ClN4O4S2 and a molecular weight of 569.11 g/mol. Its IUPAC name is N-benzyl-2-[[2-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[[2-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126390044 |
| Molecular Formula | C27H25ClN4O4S2 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | N-benzyl-2-[[2-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(CSc1nnc(COc2ccc(Cl)cc2)o1)Nc1sc2c(c1C(=O)NCc1ccccc1)CCCC2 |
| InChI | InChI=1S/C27H25ClN4O4S2/c28-18-10-12-19(13-11-18)35-15-23-31-32-27(36-23)37-16-22(33)30-26-24(20-8-4-5-9-21(20)38-26)25(34)29-14-17-6-2-1-3-7-17/h1-3,6-7,10-13H,4-5,8-9,14-16H2,(H,29,34)(H,30,33) |
| InChIKey | MHRSTZMQHUUKMV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |