C24H23N3O5S — CID 126063697
N-benzyl-2-[[2-(4-nitrophenoxy)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126063697) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is N-benzyl-2-[[2-(4-nitrophenoxy)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[[2-(4-nitrophenoxy)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126063697 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-benzyl-2-[[2-(4-nitrophenoxy)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)Nc1sc2c(c1C(=O)NCc1ccccc1)CCCC2 |
| InChI | InChI=1S/C24H23N3O5S/c28-21(15-32-18-12-10-17(11-13-18)27(30)31)26-24-22(19-8-4-5-9-20(19)33-24)23(29)25-14-16-6-2-1-3-7-16/h1-3,6-7,10-13H,4-5,8-9,14-15H2,(H,25,29)(H,26,28) |
| InChIKey | VPPZWWQQEOJOCV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|