C27H28N4O5S — CID 16559640
N-benzyl-2-[(2-morpholin-4-yl-5-nitrobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 16559640) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-benzyl-2-[(2-morpholin-4-yl-5-nitrobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[(2-morpholin-4-yl-5-nitrobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 16559640 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | N-benzyl-2-[(2-morpholin-4-yl-5-nitrobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(Nc1sc2c(c1C(=O)NCc1ccccc1)CCCC2)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C27H28N4O5S/c32-25(21-16-19(31(34)35)10-11-22(21)30-12-14-36-15-13-30)29-27-24(20-8-4-5-9-23(20)37-27)26(33)28-17-18-6-2-1-3-7-18/h1-3,6-7,10-11,16H,4-5,8-9,12-15,17H2,(H,28,33)(H,29,32) |
| InChIKey | MVQWTGWIGHLREC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|