C19H17ClN4O3S2 — CID 78772086
2-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 78772086) has the molecular formula C19H17ClN4O3S2 and a molecular weight of 448.96 g/mol. Its IUPAC name is 2-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 78772086 |
| Molecular Formula | C19H17ClN4O3S2 |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)CSc2nnc(-c3ccccc3Cl)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C19H17ClN4O3S2/c20-12-7-3-1-5-10(12)17-23-24-19(27-17)28-9-14(25)22-18-15(16(21)26)11-6-2-4-8-13(11)29-18/h1,3,5,7H,2,4,6,8-9H2,(H2,21,26)(H,22,25) |
| InChIKey | ODGYKVTULTXTDI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |