C21H20ClN3O6S2 — CID 4550490
ethyl 2-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4550490) has the molecular formula C21H20ClN3O6S2 and a molecular weight of 509.99 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4550490 |
| Molecular Formula | C21H20ClN3O6S2 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | ethyl 2-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CS(=O)(=O)c2nnc(-c3ccccc3Cl)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H20ClN3O6S2/c1-2-30-20(27)17-13-8-4-6-10-15(13)32-19(17)23-16(26)11-33(28,29)21-25-24-18(31-21)12-7-3-5-9-14(12)22/h3,5,7,9H,2,4,6,8,10-11H2,1H3,(H,23,26) |
| InChIKey | BGUCINDHROGFPV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |