C24H27N3O6S2 — CID 3334779
methyl 2-[[2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3334779) has the molecular formula C24H27N3O6S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3334779 |
| Molecular Formula | C24H27N3O6S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | methyl 2-[[2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CS(=O)(=O)c2nnc(-c3ccc(C(C)(C)C)cc3)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C24H27N3O6S2/c1-24(2,3)15-11-9-14(10-12-15)20-26-27-23(33-20)35(30,31)13-18(28)25-21-19(22(29)32-4)16-7-5-6-8-17(16)34-21/h9-12H,5-8,13H2,1-4H3,(H,25,28) |
| InChIKey | UPASDKZIYBGSFZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |