C22H23N3O7S2 — CID 3554441
methyl 2-[[2-[[5-(4-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3554441) has the molecular formula C22H23N3O7S2 and a molecular weight of 505.57 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(4-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(4-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3554441 |
| Molecular Formula | C22H23N3O7S2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | methyl 2-[[2-[[5-(4-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOc1ccc(-c2nnc(S(=O)(=O)CC(=O)Nc3sc4c(c3C(=O)OC)CCCC4)o2)cc1 |
| InChI | InChI=1S/C22H23N3O7S2/c1-3-31-14-10-8-13(9-11-14)19-24-25-22(32-19)34(28,29)12-17(26)23-20-18(21(27)30-2)15-6-4-5-7-16(15)33-20/h8-11H,3-7,12H2,1-2H3,(H,23,26) |
| InChIKey | VQGAVQIEZXJZPT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |