C21H21N3O6S2 — CID 4138817
ethyl 2-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4138817) has the molecular formula C21H21N3O6S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is ethyl 2-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4138817 |
| Molecular Formula | C21H21N3O6S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | ethyl 2-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CS(=O)(=O)c2nnc(-c3ccccc3)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H21N3O6S2/c1-2-29-20(26)17-14-10-6-7-11-15(14)31-19(17)22-16(25)12-32(27,28)21-24-23-18(30-21)13-8-4-3-5-9-13/h3-5,8-9H,2,6-7,10-12H2,1H3,(H,22,25) |
| InChIKey | MCVGDOZBTNHTJW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |