C27H33N5O2S2 — CID 17306055
N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-methyl-5-[1-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17306055) has the molecular formula C27H33N5O2S2 and a molecular weight of 523.73 g/mol. Its IUPAC name is N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-methyl-5-[1-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-methyl-5-[1-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17306055 |
| Molecular Formula | C27H33N5O2S2 |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-methyl-5-[1-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(OC(C)c2nnc(SCC(=O)Nc3sc4c(c3C#N)CCC(C(C)(C)C)C4)n2C)cc1 |
| InChI | InChI=1S/C27H33N5O2S2/c1-16-7-10-19(11-8-16)34-17(2)24-30-31-26(32(24)6)35-15-23(33)29-25-21(14-28)20-12-9-18(27(3,4)5)13-22(20)36-25/h7-8,10-11,17-18H,9,12-13,15H2,1-6H3,(H,29,33) |
| InChIKey | DFKOEXZQGPXXAF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |