C29H31N5O3S2 — CID 17047164
ethyl 2-[3-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17047164) has the molecular formula C29H31N5O3S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is ethyl 2-[3-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17047164 |
| Molecular Formula | C29H31N5O3S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | ethyl 2-[3-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCSc2nnc(CNc3ccccc3)n2-c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C29H31N5O3S2/c1-2-37-28(36)26-22-15-9-10-16-23(22)39-27(26)31-25(35)17-18-38-29-33-32-24(19-30-20-11-5-3-6-12-20)34(29)21-13-7-4-8-14-21/h3-8,11-14,30H,2,9-10,15-19H2,1H3,(H,31,35) |
| InChIKey | NIHDWAXNEDBSOE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |