C25H29N3O4S2 — CID 23889160
ethyl 2-[3-(3-methyl-4-oxoquinazolin-2-yl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 23889160) has the molecular formula C25H29N3O4S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is ethyl 2-[3-(3-methyl-4-oxoquinazolin-2-yl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(3-methyl-4-oxoquinazolin-2-yl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23889160 |
| Molecular Formula | C25H29N3O4S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | ethyl 2-[3-(3-methyl-4-oxoquinazolin-2-yl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCSc2nc3ccccc3c(=O)n2C)sc2c1CCCCCC2 |
| InChI | InChI=1S/C25H29N3O4S2/c1-3-32-24(31)21-17-11-6-4-5-7-13-19(17)34-22(21)27-20(29)14-15-33-25-26-18-12-9-8-10-16(18)23(30)28(25)2/h8-10,12H,3-7,11,13-15H2,1-2H3,(H,27,29) |
| InChIKey | WZVCVZJJQYNGNB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |