C30H31N3O4S2 — CID 23804137
ethyl 2-[3-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 23804137) has the molecular formula C30H31N3O4S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is ethyl 2-[3-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23804137 |
| Molecular Formula | C30H31N3O4S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | ethyl 2-[3-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCSc2nc3ccccc3c(=O)n2-c2ccccc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C30H31N3O4S2/c1-2-37-29(36)26-22-15-8-3-4-9-17-24(22)39-27(26)32-25(34)18-19-38-30-31-23-16-11-10-14-21(23)28(35)33(30)20-12-6-5-7-13-20/h5-7,10-14,16H,2-4,8-9,15,17-19H2,1H3,(H,32,34) |
| InChIKey | ZSJVEOROQMZJRC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |