C28H27BrN4O3S2 — CID 17047222
ethyl 2-[3-[[5-(3-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17047222) has the molecular formula C28H27BrN4O3S2 and a molecular weight of 611.59 g/mol. Its IUPAC name is ethyl 2-[3-[[5-(3-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[[5-(3-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17047222 |
| Molecular Formula | C28H27BrN4O3S2 |
| Molecular Weight | 611.59 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | ethyl 2-[3-[[5-(3-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCSc2nnc(-c3cccc(Br)c3)n2-c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C28H27BrN4O3S2/c1-2-36-27(35)24-21-13-6-7-14-22(21)38-26(24)30-23(34)15-16-37-28-32-31-25(18-9-8-10-19(29)17-18)33(28)20-11-4-3-5-12-20/h3-5,8-12,17H,2,6-7,13-16H2,1H3,(H,30,34) |
| InChIKey | NPJQWAPPDPZLLC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |