C26H23N5O5S2 — CID 17047567
methyl 2-[3-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 17047567) has the molecular formula C26H23N5O5S2 and a molecular weight of 549.63 g/mol. Its IUPAC name is methyl 2-[3-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17047567 |
| Molecular Formula | C26H23N5O5S2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | methyl 2-[3-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCSc2nnc(-c3cccc([N+](=O)[O-])c3)n2-c2ccccc2)sc2c1CCC2 |
| InChI | InChI=1S/C26H23N5O5S2/c1-36-25(33)22-19-11-6-12-20(19)38-24(22)27-21(32)13-14-37-26-29-28-23(30(26)17-8-3-2-4-9-17)16-7-5-10-18(15-16)31(34)35/h2-5,7-10,15H,6,11-14H2,1H3,(H,27,32) |
| InChIKey | WNZOWZYPBONVLO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|