C23H27N5O3S2 — CID 17047469
methyl 2-[3-[[4-amino-5-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17047469) has the molecular formula C23H27N5O3S2 and a molecular weight of 485.64 g/mol. Its IUPAC name is methyl 2-[3-[[4-amino-5-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[[4-amino-5-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17047469 |
| Molecular Formula | C23H27N5O3S2 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | methyl 2-[3-[[4-amino-5-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCSc2nnc(CCc3ccccc3)n2N)sc2c1CCCC2 |
| InChI | InChI=1S/C23H27N5O3S2/c1-31-22(30)20-16-9-5-6-10-17(16)33-21(20)25-19(29)13-14-32-23-27-26-18(28(23)24)12-11-15-7-3-2-4-8-15/h2-4,7-8H,5-6,9-14,24H2,1H3,(H,25,29) |
| InChIKey | VLZQQZZGLMTYOD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |