C29H25ClN4O4S2 — CID 4111050
ethyl 2-[[2-[[3-(4-chlorophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4111050) has the molecular formula C29H25ClN4O4S2 and a molecular weight of 593.13 g/mol. Its IUPAC name is ethyl 2-[[2-[[3-(4-chlorophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[3-(4-chlorophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4111050 |
| Molecular Formula | C29H25ClN4O4S2 |
| Molecular Weight | 593.13 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | ethyl 2-[[2-[[3-(4-chlorophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nc3c([nH]c4ccccc43)c(=O)n2-c2ccc(Cl)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C29H25ClN4O4S2/c1-2-38-28(37)23-19-8-4-6-10-21(19)40-26(23)32-22(35)15-39-29-33-24-18-7-3-5-9-20(18)31-25(24)27(36)34(29)17-13-11-16(30)12-14-17/h3,5,7,9,11-14,31H,2,4,6,8,10,15H2,1H3,(H,32,35) |
| InChIKey | GPQUOSPXRFUACH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.13 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |