C22H17ClN6O2S3 — CID 4107221
2-[[3-(4-chlorophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 4107221) has the molecular formula C22H17ClN6O2S3 and a molecular weight of 529.07 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[3-(4-chlorophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4107221 |
| Molecular Formula | C22H17ClN6O2S3 |
| Molecular Weight | 529.07 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nc3c([nH]c4ccccc43)c(=O)n2-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C22H17ClN6O2S3/c1-2-32-22-28-27-20(34-22)25-16(30)11-33-21-26-17-14-5-3-4-6-15(14)24-18(17)19(31)29(21)13-9-7-12(23)8-10-13/h3-10,24H,2,11H2,1H3,(H,25,27,30) |
| InChIKey | HXSUQBRJIXAFNW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.07 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|