C25H30N6OS — CID 51653651
2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2R)-2-methylcyclohexylidene]amino]acetamide (PubChem CID 51653651) has the molecular formula C25H30N6OS and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2R)-2-methylcyclohexylidene]amino]acetamide.
| Compound Name | 2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2R)-2-methylcyclohexylidene]amino]acetamide |
|---|---|
| PubChem CID | 51653651 |
| Molecular Formula | C25H30N6OS |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2R)-2-methylcyclohexylidene]amino]acetamide |
| SMILES | Cc1ccc(NCc2nnc(SCC(=O)N/N=C3\CCCC[C@H]3C)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H30N6OS/c1-18-12-14-20(15-13-18)26-16-23-28-30-25(31(23)21-9-4-3-5-10-21)33-17-24(32)29-27-22-11-7-6-8-19(22)2/h3-5,9-10,12-15,19,26H,6-8,11,16-17H2,1-2H3,(H,29,32)/b27-22+/t19-/m1/s1 |
| InChIKey | GYGXCXLBIGWHCU-XIGQRACRSA-N |
| XLogP | 4.96 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|