C24H27ClN6OS — CID 5119546
2-[[5-[(4-chloro-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(cyclohexylideneamino)acetamide (PubChem CID 5119546) has the molecular formula C24H27ClN6OS and a molecular weight of 483.04 g/mol. Its IUPAC name is 2-[[5-[(4-chloro-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(cyclohexylideneamino)acetamide.
| Compound Name | 2-[[5-[(4-chloro-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(cyclohexylideneamino)acetamide |
|---|---|
| PubChem CID | 5119546 |
| Molecular Formula | C24H27ClN6OS |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-[[5-[(4-chloro-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(cyclohexylideneamino)acetamide |
| SMILES | Cc1cc(Cl)ccc1NCc1nnc(SCC(=O)NN=C2CCCCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H27ClN6OS/c1-17-14-18(25)12-13-21(17)26-15-22-28-30-24(31(22)20-10-6-3-7-11-20)33-16-23(32)29-27-19-8-4-2-5-9-19/h3,6-7,10-14,26H,2,4-5,8-9,15-16H2,1H3,(H,29,32) |
| InChIKey | MFCCHVGPZBUBPX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|