C22H21ClN4O2S — CID 102123165
2-(6-chloro-4-oxo-3-phenylquinazolin-2-yl)sulfanyl-N-(cyclohexylideneamino)acetamide (PubChem CID 102123165) has the molecular formula C22H21ClN4O2S and a molecular weight of 440.96 g/mol. Its IUPAC name is 2-(6-chloro-4-oxo-3-phenylquinazolin-2-yl)sulfanyl-N-(cyclohexylideneamino)acetamide.
| Compound Name | 2-(6-chloro-4-oxo-3-phenylquinazolin-2-yl)sulfanyl-N-(cyclohexylideneamino)acetamide |
|---|---|
| PubChem CID | 102123165 |
| Molecular Formula | C22H21ClN4O2S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-(6-chloro-4-oxo-3-phenylquinazolin-2-yl)sulfanyl-N-(cyclohexylideneamino)acetamide |
| SMILES | O=C(CSc1nc2ccc(Cl)cc2c(=O)n1-c1ccccc1)NN=C1CCCCC1 |
| InChI | InChI=1S/C22H21ClN4O2S/c23-15-11-12-19-18(13-15)21(29)27(17-9-5-2-6-10-17)22(24-19)30-14-20(28)26-25-16-7-3-1-4-8-16/h2,5-6,9-13H,1,3-4,7-8,14H2,(H,26,28) |
| InChIKey | LNBRAFBFAMSVHB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|