C33H27IN6OS — CID 5153662
N-(anthracen-9-ylmethylideneamino)-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 5153662) has the molecular formula C33H27IN6OS and a molecular weight of 682.59 g/mol. Its IUPAC name is N-(anthracen-9-ylmethylideneamino)-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(anthracen-9-ylmethylideneamino)-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5153662 |
| Molecular Formula | C33H27IN6OS |
| Molecular Weight | 682.59 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | N-(anthracen-9-ylmethylideneamino)-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1cc(I)ccc1NCc1nnc(SCC(=O)NN=Cc2c3ccccc3cc3ccccc23)n1-c1ccccc1 |
| InChI | InChI=1S/C33H27IN6OS/c1-22-17-25(34)15-16-30(22)35-20-31-37-39-33(40(31)26-11-3-2-4-12-26)42-21-32(41)38-36-19-29-27-13-7-5-9-23(27)18-24-10-6-8-14-28(24)29/h2-19,35H,20-21H2,1H3,(H,38,41) |
| InChIKey | GRCNHQGYPAWPEV-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.59 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|