C27H27IN6O2S — CID 98310630
(2R)-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-methoxyphenyl)methylideneamino]propanamide (PubChem CID 98310630) has the molecular formula C27H27IN6O2S and a molecular weight of 626.52 g/mol. Its IUPAC name is (2R)-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-methoxyphenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-methoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 98310630 |
| Molecular Formula | C27H27IN6O2S |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | (2R)-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-methoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cccc(/C=N\NC(=O)[C@@H](C)Sc2nnc(CNc3ccc(I)cc3C)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C27H27IN6O2S/c1-18-14-21(28)12-13-24(18)29-17-25-31-33-27(34(25)22-9-5-4-6-10-22)37-19(2)26(35)32-30-16-20-8-7-11-23(15-20)36-3/h4-16,19,29H,17H2,1-3H3,(H,32,35)/b30-16-/t19-/m1/s1 |
| InChIKey | OTYTVPUDHOSGTC-OPLXADLCSA-N |
| XLogP | 5.43 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|