C27H27BrN6O3S — CID 3426650
N-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[(2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 3426650) has the molecular formula C27H27BrN6O3S and a molecular weight of 595.52 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[(2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[(2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 3426650 |
| Molecular Formula | C27H27BrN6O3S |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[(2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | COc1cc(Br)cc(C=NNC(=O)C(C)Sc2nnc(CNc3ccccc3C)n2-c2ccccc2)c1O |
| InChI | InChI=1S/C27H27BrN6O3S/c1-17-9-7-8-12-22(17)29-16-24-31-33-27(34(24)21-10-5-4-6-11-21)38-18(2)26(36)32-30-15-19-13-20(28)14-23(37-3)25(19)35/h4-15,18,29,35H,16H2,1-3H3,(H,32,36) |
| InChIKey | DWCXZFUDJKSISZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|