C26H24Cl2N6O3S — CID 135619867
2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]propanamide (PubChem CID 135619867) has the molecular formula C26H24Cl2N6O3S and a molecular weight of 571.49 g/mol. Its IUPAC name is 2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]propanamide.
| Compound Name | 2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135619867 |
| Molecular Formula | C26H24Cl2N6O3S |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cc(/C=N/NC(=O)C(C)Sc2nnc(CNc3ccc(Cl)cc3)n2-c2ccccc2)cc(Cl)c1O |
| InChI | InChI=1S/C26H24Cl2N6O3S/c1-16(25(36)32-30-14-17-12-21(28)24(35)22(13-17)37-2)38-26-33-31-23(34(26)20-6-4-3-5-7-20)15-29-19-10-8-18(27)9-11-19/h3-14,16,29,35H,15H2,1-2H3,(H,32,36)/b30-14+ |
| InChIKey | XUSAZYBIXDKHDA-AMVVHIIESA-N |
| XLogP | 5.53 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|