C29H25IN6O2S — CID 137195454
(2R)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 137195454) has the molecular formula C29H25IN6O2S and a molecular weight of 648.53 g/mol. Its IUPAC name is (2R)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 137195454 |
| Molecular Formula | C29H25IN6O2S |
| Molecular Weight | 648.53 g/mol |
| Exact Mass | 648.08 |
| IUPAC Name | (2R)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1nnc(CNc2ccc(I)cc2)n1-c1ccccc1)C(=O)NN=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C29H25IN6O2S/c1-19(28(38)34-32-17-25-24-10-6-5-7-20(24)11-16-26(25)37)39-29-35-33-27(36(29)23-8-3-2-4-9-23)18-31-22-14-12-21(30)13-15-22/h2-17,19,31,37H,18H2,1H3,(H,34,38)/t19-/m1/s1 |
| InChIKey | DLAJEMVZDDVCND-LJQANCHMSA-N |
| XLogP | 5.97 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|