C25H21BrIN7O4S — CID 136829482
(2S)-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 136829482) has the molecular formula C25H21BrIN7O4S and a molecular weight of 722.36 g/mol. Its IUPAC name is (2S)-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 136829482 |
| Molecular Formula | C25H21BrIN7O4S |
| Molecular Weight | 722.36 g/mol |
| Exact Mass | 720.96 |
| IUPAC Name | (2S)-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C[C@H](Sc1nnc(CNc2ccc(I)cc2)n1-c1ccccc1)C(=O)N/N=C\c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C25H21BrIN7O4S/c1-15(24(36)31-29-13-16-11-17(26)12-21(23(16)35)34(37)38)39-25-32-30-22(33(25)20-5-3-2-4-6-20)14-28-19-9-7-18(27)8-10-19/h2-13,15,28,35H,14H2,1H3,(H,31,36)/b29-13-/t15-/m0/s1 |
| InChIKey | NWBVUVUAWRJNEX-GNNWTOOISA-N |
| XLogP | 5.49 |
| TPSA | 147.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|