C27H26BrIN6O2S — CID 129440114
(2S)-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 129440114) has the molecular formula C27H26BrIN6O2S and a molecular weight of 705.42 g/mol. Its IUPAC name is (2S)-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 129440114 |
| Molecular Formula | C27H26BrIN6O2S |
| Molecular Weight | 705.42 g/mol |
| Exact Mass | 704.01 |
| IUPAC Name | (2S)-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | COc1ccc(Br)cc1C=NNC(=O)[C@H](C)Sc1nnc(CNc2ccc(I)cc2C)n1-c1ccccc1 |
| InChI | InChI=1S/C27H26BrIN6O2S/c1-17-13-21(29)10-11-23(17)30-16-25-32-34-27(35(25)22-7-5-4-6-8-22)38-18(2)26(36)33-31-15-19-14-20(28)9-12-24(19)37-3/h4-15,18,30H,16H2,1-3H3,(H,33,36)/t18-/m0/s1 |
| InChIKey | QRKCXYNGDCOJGA-SFHVURJKSA-N |
| XLogP | 6.19 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|