C26H24Cl2N6O2S — CID 3406916
N-[(2,4-dichlorophenyl)methylideneamino]-2-[[5-[(2-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 3406916) has the molecular formula C26H24Cl2N6O2S and a molecular weight of 555.49 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-2-[[5-[(2-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-2-[[5-[(2-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 3406916 |
| Molecular Formula | C26H24Cl2N6O2S |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-2-[[5-[(2-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | COc1ccccc1NCc1nnc(SC(C)C(=O)NN=Cc2ccc(Cl)cc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C26H24Cl2N6O2S/c1-17(25(35)32-30-15-18-12-13-19(27)14-21(18)28)37-26-33-31-24(34(26)20-8-4-3-5-9-20)16-29-22-10-6-7-11-23(22)36-2/h3-15,17,29H,16H2,1-2H3,(H,32,35) |
| InChIKey | NBWUGBQAOIBIDW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|