C27H27BrN6O2S — CID 129439490
(2S)-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-[[5-[(2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 129439490) has the molecular formula C27H27BrN6O2S and a molecular weight of 579.52 g/mol. Its IUPAC name is (2S)-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-[[5-[(2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-[[5-[(2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 129439490 |
| Molecular Formula | C27H27BrN6O2S |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | (2S)-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-[[5-[(2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | COc1ccc(Br)cc1C=NNC(=O)[C@H](C)Sc1nnc(CNc2ccccc2C)n1-c1ccccc1 |
| InChI | InChI=1S/C27H27BrN6O2S/c1-18-9-7-8-12-23(18)29-17-25-31-33-27(34(25)22-10-5-4-6-11-22)37-19(2)26(35)32-30-16-20-15-21(28)13-14-24(20)36-3/h4-16,19,29H,17H2,1-3H3,(H,32,35)/t19-/m0/s1 |
| InChIKey | MIVMNLALIYSONE-IBGZPJMESA-N |
| XLogP | 5.59 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|