C33H31BrN6O2S — CID 124770841
(2S)-N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 124770841) has the molecular formula C33H31BrN6O2S and a molecular weight of 655.62 g/mol. Its IUPAC name is (2S)-N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 124770841 |
| Molecular Formula | C33H31BrN6O2S |
| Molecular Weight | 655.62 g/mol |
| Exact Mass | 654.14 |
| IUPAC Name | (2S)-N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | Cc1ccc(NCc2nnc(S[C@@H](C)C(=O)NN=Cc3ccccc3OCc3cccc(Br)c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H31BrN6O2S/c1-23-15-17-28(18-16-23)35-21-31-37-39-33(40(31)29-12-4-3-5-13-29)43-24(2)32(41)38-36-20-26-10-6-7-14-30(26)42-22-25-9-8-11-27(34)19-25/h3-20,24,35H,21-22H2,1-2H3,(H,38,41)/t24-/m0/s1 |
| InChIKey | SSHDVIWRDSHGJW-DEOSSOPVSA-N |
| XLogP | 7.16 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|