C27H24ClN7OS — CID 136774334
(2S)-2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]propanamide (PubChem CID 136774334) has the molecular formula C27H24ClN7OS and a molecular weight of 530.06 g/mol. Its IUPAC name is (2S)-2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]propanamide.
| Compound Name | (2S)-2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]propanamide |
|---|---|
| PubChem CID | 136774334 |
| Molecular Formula | C27H24ClN7OS |
| Molecular Weight | 530.06 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | (2S)-2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]propanamide |
| SMILES | C[C@H](Sc1nnc(CNc2ccc(Cl)cc2)n1-c1ccccc1)C(=O)N/N=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H24ClN7OS/c1-18(26(36)33-31-16-19-15-30-24-10-6-5-9-23(19)24)37-27-34-32-25(35(27)22-7-3-2-4-8-22)17-29-21-13-11-20(28)12-14-21/h2-16,18,29-30H,17H2,1H3,(H,33,36)/b31-16-/t18-/m0/s1 |
| InChIKey | XTUVPZSEFLRRBC-GQXBYODGSA-N |
| XLogP | 5.64 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.06 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|